CAS:62802-42-0 | 2-Chloro-5-fluoropyrimidine
Molecular Formula:C4H2ClFN2
Molecular Weight:132.52g/mol
Purity:98%
Package:5g/10g/25g/50g/bulk package
Transportation:FeDex/DHL/Ocean shipping/Clients requirement
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
Applications
2-Chloro-5-fluoropyrimidine(CAS:62802-42-0) is used in various scientific research applications, such as organic synthesis, drug discovery, and biochemistry. It is used as a building block for the synthesis of various compounds, such as pharmaceuticals, agrochemicals, and specialty chemicals. Additionally, 2-Cl-5-F-Pyrimidine is used in the synthesis of various fluorinated compounds, such as fluorinated nucleosides and fluorinated amino acids. It is also used as a starting material for the synthesis of various pyrimidine derivatives, such as 5-fluorouracil and 5-fluorocytosine.
Specification
|
ITEMS |
SPECIFICATION |
|
IUPAC Name |
2-chloro-5-fluoropyrimidine |
|
MDL No |
MFCD03788197 |
|
Boiling Point |
227.4°C at 760 mmHg |
|
Flash Point |
65°C |
|
Appearance |
Colorless to light gray (Liquid) |
|
pKa |
-2.54±0.22(Predicted) |
|
Storage condition |
Inert atmosphere, Room Temperature |
|
InChI |
InChI=1S/C4H2ClFN2/c5-4-7-1-3(6)2-8-4/h1-2H |
|
InChIKey |
AGYUQBNABXVWMS-UHFFFAOYSA-N |
Hot Tags: cas:62802-42-0 | 2-chloro-5-fluoropyrimidine, price, quotation, discount, in stock, for sale, Dyes Indicators
![CAS: 160911-42-2 Imidazo[1,2-b]pyridazine-2-carboxylic Acid (9CI)](/uploads/202235855/small/cas-160911-42-2-imidazo-1-2-b-pyridazine-238150161559.png?size=384x0)
